Nama produk |
3-Fluoro-4-methylbenzaldehyde |
Sinonim |
3-Fluoro-p-tolualdehyde |
MF |
C8H7FO |
Berat Molekul |
138.139 |
InChI |
InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
CAS NO |
177756-62-6 |
Struktur Molekul |
|
Kepadatan |
1.136g/cm3 |
Titik didih |
198.3°C at 760 mmHg |
Indeks bias |
1.534 |
Titik nyala |
80.1°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|