product Name |
2-Fluorobiphenyl-4-boronic acid |
Synonyms |
3-Fluoro-4-phenylbenzeneboronic acid; 2-Fluoro-4-biphenylylboronic acid; (2-fluorobiphenyl-4-yl)boronic acid; (3-fluorobiphenyl-4-yl)boronic acid |
Molecular Formula |
C12H10BFO2 |
Molecular Weight |
216.016 |
InChI |
InChI=1/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H |
CAS Registry Number |
178305-99-2 |
Molecular Structure |
|
Density |
1.257g/cm3 |
Melting point |
243-248℃ |
Boiling point |
384.155°C at 760 mmHg |
Refractive index |
1.591 |
Flash point |
186.131°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S22:;
S24/25:;
|
|