Nome del prodotto |
TNFR-Fc fusion protein |
Sinonimi |
Etanercept [USAN]; 1-235-Tumor necrosis factor receptor (human) fusion protein with 236-467-immunoglobulin G1 (human gamma1-chain Fc fragment), dimer; Enbrel; Etanercept; Recombinant human TNF; Recombinant human dimeric TNF receptor type II-IgG fusion protein; TNF receptor type II-IgG fusion protein; TNFR-Fc; TNFR:Fc; TNR 001; UNII-OP401G7OJC; rhu TNFR:Fc; 1-235-Tumor necrosis factor receptor (human) fusion protein with 236-467-immunoglobulin G1 (human gamma1-chain Fc fragment); (2R,3S)-3,4-bis(nitrooxy)butane-1,2-diyl dinitrate |
Formula molecolare |
C4H6N4O12 |
Peso Molecolare |
302.11 |
InChI |
InChI=1/C4H6N4O12/c9-5(10)17-1-3(19-7(13)14)4(20-8(15)16)2-18-6(11)12/h3-4H,1-2H2/t3-,4+ |
Numero CAS |
185243-69-0 |
EINECS |
230-734-9 |
Struttura molecolare |
|
Densità |
1.757g/cm3 |
Punto di ebollizione |
381.8°C at 760 mmHg |
Indice di rifrazione |
1.511 |
Punto d'infiammabilità |
178.8°C |
|