product Name |
5-Bromo-2,3-difluorophenol |
Synonyms |
Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
Molecular Formula |
C6H3BrF2O |
Molecular Weight |
208.9882 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
CAS Registry Number |
186590-26-1 |
Molecular Structure |
|
Density |
1.858g/cm3 |
Boiling point |
212.2°C at 760 mmHg |
Refractive index |
1.549 |
Flash point |
82.1°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|