Ονομασία του προϊόντος |
Nitrilotriacetic acid, trisodium salt, monohydrate |
Συνώνυμα |
Nitrilotriacetic acid trisodium salt monohydrate; Nitriloacetic acid trisodium salt monohydrate; sodium 2,2',2''-nitrilotriacetate hydrate (3:1:1); NTA-3Na monohydrate |
MF |
C6H8NNa3O7 |
Μοριακό βάρος |
275.0995 |
InChI |
InChI=1/C6H9NO6.3Na.H2O/c8-4(9)1-7(2-5(10)11)3-6(12)13;;;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;;;1H2/q;3*+1;/p-3 |
CAS ΟΧΙ |
18662-53-8 |
EINECS |
205-355-7 |
Μοριακή δομή |
|
Σημείο τήξης |
320℃ |
Σημείο βρασμού |
498.2°C at 760 mmHg |
Σημείο ανάφλεξης |
255.1°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|