Nama produk |
2,4,6-Trichloronitro Benzene |
Sinonim |
2-Nitro-1,3,5-trichlorobenzene; 2,4,6-Trichloronitrobenzene; 1,3,5-trichloro-2-nitrobenzene |
MF |
C6H2Cl3NO2 |
Berat Molekul |
226.4446 |
InChI |
InChI=1/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
CAS NO |
18708-70-8 |
EINECS |
242-518-1 |
Struktur Molekul |
|
Kepadatan |
1.651g/cm3 |
Titik lebur |
70-72℃ |
Titik didih |
303.2°C at 760 mmHg |
Indeks bias |
1.609 |
Titik nyala |
137.2°C |
Kod Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|