termék neve |
2-Methoxyphenoxyacetic acid |
Szinonimák |
Guaiacoxyacetic acid; (2-Methoxyphenoxy)acetic acid; (o-Methoxyphenoxy)acetic acid; 3-06-00-04234 (Beilstein Handbook Reference); AI3-10575; Acide o-methoxyphenoxyacetique; Acide o-methoxyphenoxyacetique [French]; BRN 1874501; NSC 5165; Acetic acid, (2-methoxyphenoxy)-; Acetic acid, (o-methoxyphenoxy)-; (2-methoxyphenoxy)acetate |
MF |
C9H9O4 |
Molekulatömeg |
181.1659 |
InChI |
InChI=1/C9H10O4/c1-12-7-4-2-3-5-8(7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
CAS-szám |
1878-85-9 |
EINECS |
217-526-3 |
Molekuláris szerkezete |
|
Olvadáspont |
120-122℃ |
Forráspont |
303°C at 760 mmHg |
Gyulladáspont |
120.9°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|