Nome del prodotto |
2-Acetyl-3-methylbenzo[b]thiophene |
Sinonimi |
2-Acetyl-3-methylthianaphthene; 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one; 1-(3-methyl-1-benzothiophen-6-yl)ethanone; 1-(3-methyl-1-benzothiophen-2-yl)ethanone |
Formula molecolare |
C11H10OS |
Peso Molecolare |
190.2615 |
InChI |
InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
Numero CAS |
18781-31-2 |
Struttura molecolare |
|
Densità |
1.182g/cm3 |
Punto di fusione |
79℃ |
Punto di ebollizione |
319.5°C at 760 mmHg |
Indice di rifrazione |
1.631 |
Punto d'infiammabilità |
147°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|