termék neve |
Benzo[ghi]perylene |
Szinonimák |
1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
MF |
C22H12 |
Molekulatömeg |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
CAS-szám |
191-24-2 |
EINECS |
205-883-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.378g/cm3 |
Olvadáspont |
276-280℃ |
Forráspont |
501°C at 760 mmHg |
Törésmutató |
2.009 |
Gyulladáspont |
247.2°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R40:Possible risks of irreversible effects.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|