שם המוצר |
5-Chloro-2-methylphenyl isothiocyanate |
נרדפות |
3-Chloro-6-methylisothiocyanatobenzene; 4-chloro-2-isothiocyanato-1-methylbenzene |
מולקולרית פורמולה |
C8H6ClNS |
משקל מולקולרי |
183.6579 |
InChI |
InChI=1/C8H6ClNS/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3 |
מספר CAS |
19241-36-2 |
מבנה מולקולרי |
|
צפיפות |
1.18g/cm3 |
נקודת רתיחה |
293°C at 760 mmHg |
משקל סגולי |
1.583 |
נקודת הבזק |
131°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|