نام محصول |
4-Bromo-2-methylphenyl isothiocyanate |
مترادف |
4-Bromo-2-methylisothiocyanatobenzene; 4-bromo-1-isothiocyanato-2-methylbenzene; 1-bromo-4-isothiocyanato-2-methylbenzene |
میدان مغناطیسی |
C8H6BrNS |
وزن مولکولی |
228.1089 |
InChI |
InChI=1/C8H6BrNS/c1-6-4-7(10-5-11)2-3-8(6)9/h2-4H,1H3 |
شماره سیایاس |
19241-38-4 |
تعداد کمیسیون اروپایی |
242-907-6 |
ساختار مولکولی |
|
تراکم |
1.44g/cm3 |
نقطه غلیان |
307.9°C at 760 mmHg |
ضریب شکست |
1.608 |
نقطه اشتعال |
140°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|