Nazwa produktu: |
3-Chloro-4-fluorobenzyl bromide |
Synonimy |
alpha-Bromo-3-chloro-4-fluorotoluene; 4-(bromomethyl)-2-chloro-1-fluorobenzene |
MF |
C7H5BrClF |
Masie cząsteczkowej |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-4-5-1-2-7(10)6(9)3-5/h1-3H,4H2 |
Nr CAS |
192702-01-5 |
Struktury molekularnej |
|
Gęstość |
1.654g/cm3 |
Temperatura wrzenia |
235°C at 760 mmHg |
Współczynnik załamania |
1.561 |
Temperatura zapłonu |
95.9°C |
Kody ryzyka |
R34:Causes burns.;
R36:Irritating to eyes.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|