نام محصول |
4,4'-Dichlorochalcone |
مترادف |
1,3-bis(4-chlorophenyl)prop-2-en-1-one; (2E)-1,3-bis(4-chlorophenyl)prop-2-en-1-one |
میدان مغناطیسی |
C15H10Cl2O |
وزن مولکولی |
277.1453 |
InChI |
InChI=1/C15H10Cl2O/c16-13-6-1-11(2-7-13)3-10-15(18)12-4-8-14(17)9-5-12/h1-10H/b10-3+ |
شماره سیایاس |
19672-59-4 |
ساختار مولکولی |
|
تراکم |
1.296g/cm3 |
نقطه غلیان |
420.1°C at 760 mmHg |
ضریب شکست |
1.638 |
نقطه اشتعال |
177.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|