product Name |
1,3-Phenylenediacetic acid |
Synonyms |
m-Phenylendiacetic acid; Benzene-1,3-diacetic acid; 1,3-Bis-(carboxymethyl)-benzene; 2,2'-benzene-1,2-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetic acid; 2,2'-benzene-1,3-diyldiacetate |
Molecular Formula |
C10H8O4 |
Molecular Weight |
192.1692 |
InChI |
InChI=1/C10H10O4/c11-9(12)5-7-2-1-3-8(4-7)6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14)/p-2 |
CAS Registry Number |
19806-17-8 |
EINECS |
243-332-3 |
Molecular Structure |
|
Melting point |
173-177℃ |
Boiling point |
408.6°C at 760 mmHg |
Flash point |
215.1°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|