Nome del prodotto |
2-Bromo-5-iodotoluene |
Sinonimi |
1-bromo-4-iodo-2-methylbenzene |
Formula molecolare |
C7H6BrI |
Peso Molecolare |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
Numero CAS |
202865-85-8 |
Struttura molecolare |
|
Densità |
2.062g/cm3 |
Punto di ebollizione |
264.2°C at 760 mmHg |
Indice di rifrazione |
1.636 |
Punto d'infiammabilità |
113.6°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|