product Name |
4-Hydroxychalcone |
Synonyms |
4-Hydroxybenzylideneacetophenone; 3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-hydroxyphenyl)-1-phenylprop-2-en-1-one |
Molecular Formula |
C15H12O2 |
Molecular Weight |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11,16H/b11-8+ |
CAS Registry Number |
20426-12-4 |
Molecular Structure |
|
Density |
1.191g/cm3 |
Melting point |
183-185℃ |
Boiling point |
394.9°C at 760 mmHg |
Refractive index |
1.653 |
Flash point |
168.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|