उत्पाद का नाम |
3-Amino-4-chloropyridine |
समानार्थी |
4-Chloro-3-pyridinamine; 4-Chloro-3-aminopyridine; 4-chloropyridin-3-amine; 4-CHLORO-PYRIDIN-3-YLAMINE |
आणविक फार्मूला |
C5H5ClN2 |
आण्विक वजन |
128.5596 |
InChI |
InChI=1/C5H5ClN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 |
कैस रजिस्टी संख्या |
20511-15-3 |
आणविक संरचना |
|
घनत्व |
1.326g/cm3 |
उबलने का समय |
247.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.607 |
फ्लैश प्वाइंट |
103.5°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|