상품명칭 |
2,5-Dimethyl-2,4-hexadienedioic Acid |
별명 |
a,a-Dimethylmuconic acid; 2,5-dimethylhexa-2,4-dienedioic acid; (2E,4E)-2,5-dimethylhexa-2,4-dienedioic acid |
분자식 |
C8H10O4 |
분자량 |
170.1626 |
InChI |
InChI=1/C8H10O4/c1-5(7(9)10)3-4-6(2)8(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/b5-3+,6-4+ |
cas번호 |
20514-41-4 |
분자 구조 |
|
밀도 |
1.245g/cm3 |
비등점 |
351°C at 760 mmHg |
굴절 지수 |
1.527 |
인화점 |
180.3°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|