상품명칭 |
1-(4'-Iodophenyl)butane |
별명 |
1-n-Butyl-4-iodobenzene; +4-n-Butyliodobenzene; 4-Iodo-n-butylbenzene; 1-butyl-4-iodobenzene |
분자식 |
C10H13I |
분자량 |
260.1147 |
InChI |
InChI=1/C10H13I/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
cas번호 |
20651-67-6 |
분자 구조 |
|
밀도 |
1.466g/cm3 |
비등점 |
248.4°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
108.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|