نام محصول |
5-Acetylthiophene-2-boronic acid |
مترادف |
(5-acetylthiophen-2-yl)boronic acid; 5-Acetyl-2-thiopheneboronic acid; 2-Acetylthiphene-2-boronic acid; 2-ACETYLTHIOPHENE-5-BORONIC ACID; 5-Acetyl-2-thienylboronicAcid; 5-Acetylthiophen-2-Ylboronic Acid |
میدان مغناطیسی |
C6H7BO3S |
وزن مولکولی |
169.994 |
InChI |
InChI=1/C6H7BO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3,9-10H,1H3 |
شماره سیایاس |
206551-43-1 |
ساختار مولکولی |
|
تراکم |
1.34g/cm3 |
نقطه ذوب |
133-138℃ |
نقطه غلیان |
399.3°C at 760 mmHg |
ضریب شکست |
1.556 |
نقطه اشتعال |
195.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|