उत्पाद का नाम |
4-Bromo-2,5-difluorobenzenesulphonyl chloride |
समानार्थी |
4-bromo-2,5-difluorobenzenesulfonyl chloride; 3,4-dihydro-2H-chromen-2-ylmethanol; 1,3-difluoro-2-isothiocyanatobenzene |
आणविक फार्मूला |
C7H3F2NS |
आण्विक वजन |
171.1672 |
InChI |
InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
कैस रजिस्टी संख्या |
207974-14-9 |
आणविक संरचना |
|
घनत्व |
1.26g/cm3 |
गलनांक |
37℃ |
उबलने का समय |
221.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.536 |
फ्लैश प्वाइंट |
87.8°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|