Ürün Adı |
2,3-difluorocinnamic acid |
Eş anlamlı |
(2E)-3-(2,3-difluorophenyl)prop-2-enoic acid; (2E)-3-(2,3-difluorophenyl)prop-2-enoate |
Moleküler Formülü |
C9H5F2O2 |
Molekül Ağırlığı |
183.1322 |
InChI |
InChI=1/C9H6F2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
CAS kayıt numarası |
207981-48-4 |
Moleküler Yapısı |
|
Kaynama noktası |
281.3°C at 760 mmHg |
Alevlenme noktası |
124°C |
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|