product Name |
2,3,6-trifluoroacetophenone |
Synonyms |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
Molecular Formula |
C8H5F3O |
Molecular Weight |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
CAS Registry Number |
208173-22-2 |
Molecular Structure |
|
Density |
1.303g/cm3 |
Boiling point |
187.2°C at 760 mmHg |
Refractive index |
1.455 |
Flash point |
65°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|