Naam product |
2-Bromo-1-phenylpropane |
Synoniemen |
(2-Bromopropyl)benzene |
MF |
C9H11Br |
Molecuulgewicht |
199.0876 |
InChI |
InChI=1/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
CAS-nummer |
2114-39-8 |
EINECS |
218-315-9 |
Moleculaire Structuur |
|
Dichtheid |
1.307g/cm3 |
Kookpunt |
228°C at 760 mmHg |
Brekingsindex |
1.544 |
Vlampunt |
90.6°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|