Tri-n-butylgermanium chloride

उत्पाद का नाम	Tri-n-butylgermanium chloride
समानार्थी	Tributylgermanium chloride; Tri-n-butylchlorogermane; tributyl(chloro)germane; tributylgermanylium chloride
आणविक फार्मूला	C₁₂H₂₇ClGe
आण्विक वजन	279.4358
InChI	InChI=1/C12H27Ge.ClH/c1-4-7-10-13(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;1H/q+1;/p-1
कैस रजिस्टी संख्या	2117-36-4
EINECS	218-323-2
आणविक संरचना
खतरा प्रतीक	C:Corrosive;
खतरे के कोड	R22:Harmful if swallowed.; R34:Causes burns.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;