اسم المنتج |
4-Chlorophenyl isothiocyanate |
الاسم المستعار |
Isothiocyanic Acid 4-Chlorophenyl Ester; 1-chloro-4-isothiocyanatobenzene; 4-Chloro-phenylisothiocyanate |
الصيغة الجزيئية |
C7H4ClNS |
الوزن الجزيئي الغرامي |
169.6314 |
InChI |
InChI=1/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
إستراتيجية المساعدة القطرية |
2131-55-7 |
المفوضية الأوروبية رقم |
218-358-3 |
بنية جزيئية |
|
كثافة |
1.21g/cm3 |
درجة الإنصهار |
43-136℃ |
نقطة الغليان |
250.2°C at 760 mmHg |
معامل الإنكسار |
1.593 |
نقطة الوميض |
105.1°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|