اسم المنتج |
Methyl 3,4-dihydroxybenzoate |
الاسم المستعار |
3,4-Dihydroxybenzoic acid methyl ester; Methyl protocatechuate |
الصيغة الجزيئية |
C8H8O4 |
الوزن الجزيئي الغرامي |
168.1467 |
InChI |
InChI=1/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
إستراتيجية المساعدة القطرية |
2150-43-8 |
بنية جزيئية |
|
كثافة |
1.354g/cm3 |
نقطة الغليان |
351.5°C at 760 mmHg |
معامل الإنكسار |
1.587 |
نقطة الوميض |
148.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|