상품명칭 |
7-Bromo-1-chloroisoquinoline |
별명 |
1-Chloro-7-bromoisoquinoline |
분자식 |
C9H5BrClN |
분자량 |
242.4997 |
InChI |
InChI=1/C9H5BrClN/c10-7-2-1-6-3-4-12-9(11)8(6)5-7/h1-5H |
cas번호 |
215453-51-3 |
분자 구조 |
|
밀도 |
1.673g/cm3 |
비등점 |
349.497°C at 760 mmHg |
굴절 지수 |
1.68 |
인화점 |
165.17°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|