termék neve |
1-(2-chloro-6-fluorobenzyl)piperazine |
MF |
C11H14ClFN2 |
Molekulatömeg |
228.6937 |
InChI |
InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
CAS-szám |
215655-20-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.216g/cm3 |
Forráspont |
299.7°C at 760 mmHg |
Törésmutató |
1.544 |
Gyulladáspont |
135°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|