Naam product |
3-(2-Carboxyvinyl)benzeneboronic acid |
Synoniemen |
3-(2-Carboxyvinyl)phenylboronic acid; 3-Boronocinnamic acid; (2E)-3-[3-(dihydroxyboranyl)phenyl]prop-2-enoic acid |
MF |
C9H9BO4 |
Molecuulgewicht |
191.9764 |
InChI |
InChI=1/C9H9BO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6,13-14H,(H,11,12)/b5-4+ |
CAS-nummer |
216144-91-1 |
Moleculaire Structuur |
|
Dichtheid |
1.33g/cm3 |
Kookpunt |
454.1°C at 760 mmHg |
Brekingsindex |
1.591 |
Vlampunt |
228.4°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|