Ονομασία του προϊόντος |
2,3,4,5-Tetrafluorobenzylchloride |
Συνώνυμα |
2,3,4,6-Tetrafluorobenzyl chloride; 2-(chloromethyl)-1,3,4,5-tetrafluorobenzene |
MF |
C7H3ClF4 |
Μοριακό βάρος |
198.5453 |
InChI |
InChI=1/C7H3ClF4/c8-2-3-4(9)1-5(10)7(12)6(3)11/h1H,2H2 |
CAS ΟΧΙ |
21622-18-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.482g/cm3 |
Σημείο βρασμού |
164.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.449 |
Σημείο ανάφλεξης |
57.5°C |
Κινδύνου Κώδικες |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|