Nome del prodotto |
4-Bromo-2-fluorobenzeneboronic acid |
Sinonimi |
4-Bromo-2-fluorophenylboronic acid |
Formula molecolare |
C6H5BBrFO2 |
Peso Molecolare |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H |
Numero CAS |
216393-64-5 |
Struttura molecolare |
|
Densità |
1.75g/cm3 |
Punto di ebollizione |
310.6°C at 760 mmHg |
Indice di rifrazione |
1.571 |
Punto d'infiammabilità |
141.6°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|