trans-4-(beta-Nitrovinyl)benzeneboronic acid

상품명칭	trans-4-(beta-Nitrovinyl)benzeneboronic acid
별명	4-Borono-trans-beta-nitrostyrene; trans-4-(beta-Nitrovinyl)phenylboronic acid; 4-[(E)-2-nitrovinyl]phenylboronic acid; {4-[(E)-2-nitroethenyl]phenyl}boronic acid; (E)-(4-(2-Nitrovinyl)phenyl)boronicacid
분자식	C₈H₈BNO₄
분자량	192.9644
InChI	InChI=1/C8H8BNO4/c11-9(12)8-3-1-7(2-4-8)5-6-10(13)14/h1-6,11-12H/b6-5+
cas번호	216394-04-6
분자 구조
밀도	1.32g/cm³
비등점	412.6°C at 760 mmHg
굴절 지수	1.581
인화점	203.3°C
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;