상품명칭 |
trans-4-(beta-Nitrovinyl)benzeneboronic acid |
별명 |
4-Borono-trans-beta-nitrostyrene; trans-4-(beta-Nitrovinyl)phenylboronic acid; 4-[(E)-2-nitrovinyl]phenylboronic acid; {4-[(E)-2-nitroethenyl]phenyl}boronic acid; (E)-(4-(2-Nitrovinyl)phenyl)boronicacid |
분자식 |
C8H8BNO4 |
분자량 |
192.9644 |
InChI |
InChI=1/C8H8BNO4/c11-9(12)8-3-1-7(2-4-8)5-6-10(13)14/h1-6,11-12H/b6-5+ |
cas번호 |
216394-04-6 |
분자 구조 |
|
밀도 |
1.32g/cm3 |
비등점 |
412.6°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
203.3°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|