product Name |
2',6'-Dimethylacetanilide |
Synonyms |
2,6-Acetoxylidide; N-(2,6-Dimethylphenyl)acetamide |
Molecular Formula |
C10H13NO |
Molecular Weight |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-7-5-4-6-8(2)10(7)11-9(3)12/h4-6H,1-3H3,(H,11,12) |
CAS Registry Number |
2198-53-0 |
EINECS |
218-596-8 |
Molecular Structure |
|
Density |
1.052g/cm3 |
Melting point |
178-184℃ |
Boiling point |
282.6°C at 760 mmHg |
Refractive index |
1.56 |
Flash point |
163°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|