اسم المنتج |
3,4,5-trifluoroacetophenone |
الاسم المستعار |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
الصيغة الجزيئية |
C8H5F3O |
الوزن الجزيئي الغرامي |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
إستراتيجية المساعدة القطرية |
220141-73-1 |
بنية جزيئية |
|
كثافة |
1.303g/cm3 |
نقطة الغليان |
208.8°C at 760 mmHg |
معامل الإنكسار |
1.455 |
نقطة الوميض |
72.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|