Nome del prodotto |
4-Methylbenzyl acetate |
Sinonimi |
Benzenemethanol, 4-methyl-, 1-acetate; 4-06-00-03173 (Beilstein Handbook Reference); 4-Methylbenzenemethanol acetate; 4-Methylbenzyl ethanoate; AI3-20661; BRN 2046163; NSC 7001; p-Acetoxymethyltoluene; p-Methylbenzyl acetate; p-Methylbenzyl alcohol acetate; p-Tolubenzyl acetate; p-Xylene, alpha-acetoxy; p-Xylyl acetate; Benzenemethanol, 4-methyl-, acetate; Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI) |
Formula molecolare |
C10H12O2 |
Peso Molecolare |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
Numero CAS |
2216-45-7 |
EINECS |
218-689-3 |
Struttura molecolare |
|
Densità |
1.035g/cm3 |
Punto di ebollizione |
224.5°C at 760 mmHg |
Indice di rifrazione |
1.505 |
Punto d'infiammabilità |
98°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|