نام محصول |
Ethyl phenylpropiolate |
مترادف |
Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
میدان مغناطیسی |
C11H10O2 |
وزن مولکولی |
174.1959 |
InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
شماره سیایاس |
2216-94-6 |
تعداد کمیسیون اروپایی |
218-703-8 |
ساختار مولکولی |
|
تراکم |
1.09g/cm3 |
نقطه غلیان |
265°C at 760 mmHg |
ضریب شکست |
1.538 |
نقطه اشتعال |
124.9°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|