نام محصول |
Diphenyliodonium iodide |
مترادف |
AI3-17093; Iodonium, diphenyl-, iodide |
میدان مغناطیسی |
C12H10I2 |
وزن مولکولی |
408.02 |
InChI |
InChI=1/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1 |
شماره سیایاس |
2217-79-0 |
تعداد کمیسیون اروپایی |
218-716-9 |
ساختار مولکولی |
|
نقطه ذوب |
163-165℃ |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|