Naam product |
1-Acetyl-5-bromoindoline |
Synoniemen |
1-acetyl-5-bromoindoline crystalline; 1-(5-Bromo-2,3-dihydro-1H-indol-1-yl)ethan-1-one; 1-Acetyl-5-bromo-1H-indole; 1-(5-bromo-2,3-dihydro-1H-indol-1-yl)ethanone |
MF |
C10H10BrNO |
Molecuulgewicht |
240.0965 |
InChI |
InChI=1/C10H10BrNO/c1-7(13)12-5-4-8-6-9(11)2-3-10(8)12/h2-3,6H,4-5H2,1H3 |
CAS-nummer |
22190-38-1 |
Moleculaire Structuur |
|
Dichtheid |
1.529g/cm3 |
Smeltpunt |
119-122℃ |
Kookpunt |
423.6°C at 760 mmHg |
Brekingsindex |
1.607 |
Vlampunt |
210°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|