Nazwa produktu: |
2-(difluoromethoxy)aniline |
Synonimy |
2-Difluoromethoxyaniline |
MF |
C7H7F2NO |
Masie cząsteczkowej |
159.1334 |
InChI |
InChI=1/C7H7F2NO/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2 |
Nr CAS |
22236-04-0 |
Struktury molekularnej |
|
Gęstość |
1.253g/cm3 |
Temperatura wrzenia |
209.8°C at 760 mmHg |
Współczynnik załamania |
1.501 |
Temperatura zapłonu |
80.7°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|