שם המוצר |
lauric acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
נרדפות |
Triethanolamine laurate; Dodecanoic acid, compd. with 2,2'2''-nitrilotris(ethanol) (1:1); Lauric acid, triethanolamine salt; TEA-Laurate; Caswell No. 887A; EPA Pesticide Chemical Code 079043; Dodecanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); Lauric acid, compound with 2,2',2''-nitrilotriethanol (1:1); dodecanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
מולקולרית פורמולה |
C18H39NO5 |
משקל מולקולרי |
349.506 |
InChI |
InChI=1/C12H24O2.C6H15NO3/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;8-4-1-7(2-5-9)3-6-10/h2-11H2,1H3,(H,13,14);8-10H,1-6H2 |
מספר CAS |
2224-49-9 |
EINECS |
218-749-9 |
מבנה מולקולרי |
|
נקודת רתיחה |
296.1°C at 760 mmHg |
נקודת הבזק |
134.1°C |
|