Nome del prodotto |
3-Chloro-2,6-difluorobenzoic acid |
Formula molecolare |
C7H3ClF2O2 |
Peso Molecolare |
192.5473 |
InChI |
InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
Numero CAS |
225104-76-7 |
Struttura molecolare |
|
Densità |
1.573g/cm3 |
Punto di ebollizione |
264.5°C at 760 mmHg |
Indice di rifrazione |
1.534 |
Punto d'infiammabilità |
113.8°C |
Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|