نام محصول |
1,3-Difluoro-5-iodobenzene |
مترادف |
3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
میدان مغناطیسی |
C6H3F2I |
وزن مولکولی |
239.9893 |
InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
شماره سیایاس |
2265-91-0 |
ساختار مولکولی |
|
تراکم |
2.001g/cm3 |
نقطه غلیان |
173.9°C at 760 mmHg |
ضریب شکست |
1.566 |
نقطه اشتعال |
63.8°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|