Ονομασία του προϊόντος |
2-Bromo-5-methoxybenzoic acid |
Συνώνυμα |
6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
MF |
C8H6BrO3 |
Μοριακό βάρος |
230.036 |
InChI |
InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
CAS ΟΧΙ |
22921-68-2 |
EINECS |
245-329-2 |
Μοριακή δομή |
|
Σημείο τήξης |
158-159℃ |
Σημείο βρασμού |
337.8°C at 760 mmHg |
Σημείο ανάφλεξης |
158.1°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|