اسم المنتج |
tris(3-fluorophenyl)phosphine |
الاسم المستعار |
Tris(3-fluorophenyl)phosphine; tris(3-fluorophenyl)phosphane; Tri(3-fluorophenyl)phosphine |
الصيغة الجزيئية |
C18H12F3P |
الوزن الجزيئي الغرامي |
316.2569 |
InChI |
InChI=1/C18H12F3P/c19-13-4-1-7-16(10-13)22(17-8-2-5-14(20)11-17)18-9-3-6-15(21)12-18/h1-12H |
إستراتيجية المساعدة القطرية |
23039-94-3 |
بنية جزيئية |
|
نقطة الغليان |
371.1°C at 760 mmHg |
نقطة الوميض |
178.2°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|