اسم المنتج |
dl-O-tyrosine |
الاسم المستعار |
3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH; 2-hydroxyphenylalanine; 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt) |
الصيغة الجزيئية |
C13H16N2O5 |
الوزن الجزيئي الغرامي |
280.2765 |
InChI |
InChI=1/C11H14N2O.C2H2O4/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11;3-1(4)2(5)6/h1-4,6,9,13-14H,5,7,12H2;(H,3,4)(H,5,6) |
إستراتيجية المساعدة القطرية |
2370-61-8 |
المفوضية الأوروبية رقم |
219-134-8 |
بنية جزيئية |
|
درجة الإنصهار |
260℃ |
نقطة الغليان |
654.4°C at 760 mmHg |
نقطة الوميض |
349.5°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|