نام محصول |
4-Ethoxycinnamic acid |
مترادف |
4-Ethoxycinnamic acid,predominantly trans; (2E)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2Z)-3-(4-ethoxyphenyl)prop-2-enoic acid; (2E)-3-(4-ethoxyphenyl)prop-2-enoate; 3-(4-ETHOXYPHENYL) PROPENOIC ACID |
میدان مغناطیسی |
C11H11O3 |
وزن مولکولی |
191.2038 |
InChI |
InChI=1/C11H12O3/c1-2-14-10-6-3-9(4-7-10)5-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)/p-1/b8-5+ |
شماره سیایاس |
2373-79-7 |
ساختار مولکولی |
|
نقطه ذوب |
195-199℃ |
نقطه غلیان |
353.2°C at 760 mmHg |
نقطه اشتعال |
139.2°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|