نام محصول |
3-Bromo-1,8-naphthalic anhydride |
مترادف |
5-bromo-1H,3H-benzo[de]isochromene-1,3-dione |
میدان مغناطیسی |
C12H5BrO3 |
وزن مولکولی |
277.0703 |
InChI |
InChI=1/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H |
شماره سیایاس |
24050-49-5 |
ساختار مولکولی |
|
تراکم |
1.812g/cm3 |
نقطه غلیان |
468.9°C at 760 mmHg |
ضریب شکست |
1.733 |
نقطه اشتعال |
237.4°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|