product Name |
endo-Bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylic anhydride |
Molecular Formula |
C10H10O3 |
Molecular Weight |
178.1846 |
InChI |
InChI=1/C10H10O3/c11-9-7-5-1-2-6(4-3-5)8(7)10(12)13-9/h1-2,5-8H,3-4H2 |
CAS Registry Number |
24327-08-0 |
EINECS |
246-171-7 |
Molecular Structure |
|
Density |
1.324g/cm3 |
Melting point |
144-148℃ |
Boiling point |
340.9°C at 760 mmHg |
Refractive index |
1.563 |
Flash point |
166.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S22:Do not inhale dust.;
|
|