produktnavn |
Mandelic acid hydrazide |
Synonymer |
Mandelhydrazine; Mandelic acid, hydrazide; 2-Hydroxy-2-phenylacetohydrazide; (2S)-2-hydroxy-2-phenylethanehydrazide; (2R)-2-hydroxy-2-phenylethanehydrazide |
Molekylær Formel |
C8H10N2O2 |
Molekylvekt |
166.1772 |
InChI |
InChI=1/C8H10N2O2/c9-10-8(12)7(11)6-4-2-1-3-5-6/h1-5,7,11H,9H2,(H,10,12)/t7-/m1/s1 |
CAS-nummer |
2443-66-5 |
Molecular Structure |
|
Tetthet |
1.277g/cm3 |
Kokepunkt |
420.9°C at 760 mmHg |
Brytningsindeks |
1.599 |
Flammepunktet |
208.3°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|